C24H23F3N2O5 — CID 3861604
5-benzyl-4,6-dioxo-3-propan-2-yl-1-[4-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3861604) has the molecular formula C24H23F3N2O5 and a molecular weight of 476.45 g/mol. Its IUPAC name is 5-benzyl-4,6-dioxo-3-propan-2-yl-1-[4-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-4,6-dioxo-3-propan-2-yl-1-[4-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3861604 |
| Molecular Formula | C24H23F3N2O5 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 5-benzyl-4,6-dioxo-3-propan-2-yl-1-[4-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)C1(C(=O)O)NC(c2ccc(OC(F)(F)F)cc2)C2C(=O)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C24H23F3N2O5/c1-13(2)23(22(32)33)18-17(20(30)29(21(18)31)12-14-6-4-3-5-7-14)19(28-23)15-8-10-16(11-9-15)34-24(25,26)27/h3-11,13,17-19,28H,12H2,1-2H3,(H,32,33) |
| InChIKey | JUQOJFABYUBNDE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|