C30H28N2O5 — CID 3744558
5-benzyl-3-(1-hydroxyethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3744558) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is 5-benzyl-3-(1-hydroxyethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-3-(1-hydroxyethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3744558 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 5-benzyl-3-(1-hydroxyethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(O)C1(C(=O)O)NC(c2ccc(C=Cc3ccccc3)cc2)C2C(=O)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C30H28N2O5/c1-19(33)30(29(36)37)25-24(27(34)32(28(25)35)18-22-10-6-3-7-11-22)26(31-30)23-16-14-21(15-17-23)13-12-20-8-4-2-5-9-20/h2-17,19,24-26,31,33H,18H2,1H3,(H,36,37) |
| InChIKey | ODOLWUUNVMICCA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|