C35H36N2O4 — CID 5019796
5-benzyl-3-(cyclohexylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5019796) has the molecular formula C35H36N2O4 and a molecular weight of 548.68 g/mol. Its IUPAC name is 5-benzyl-3-(cyclohexylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-3-(cyclohexylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5019796 |
| Molecular Formula | C35H36N2O4 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 5-benzyl-3-(cyclohexylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3ccc(C=Cc4ccccc4)cc3)NC(CC3CCCCC3)(C(=O)O)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C35H36N2O4/c38-32-29-30(33(39)37(32)23-27-14-8-3-9-15-27)35(34(40)41,22-26-12-6-2-7-13-26)36-31(29)28-20-18-25(19-21-28)17-16-24-10-4-1-5-11-24/h1,3-5,8-11,14-21,26,29-31,36H,2,6-7,12-13,22-23H2,(H,40,41) |
| InChIKey | GUALWDDVJOKLNP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|