C31H36N4O5 — CID 3368259
3-[3-(carbamoylamino)propyl]-5-cyclohexyl-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3368259) has the molecular formula C31H36N4O5 and a molecular weight of 544.65 g/mol. Its IUPAC name is 3-[3-(carbamoylamino)propyl]-5-cyclohexyl-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-[3-(carbamoylamino)propyl]-5-cyclohexyl-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3368259 |
| Molecular Formula | C31H36N4O5 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 3-[3-(carbamoylamino)propyl]-5-cyclohexyl-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | NC(=O)NCCCC1(C(=O)O)NC(c2ccc(C=Cc3ccccc3)cc2)C2C(=O)N(C3CCCCC3)C(=O)C21 |
| InChI | InChI=1S/C31H36N4O5/c32-30(40)33-19-7-18-31(29(38)39)25-24(27(36)35(28(25)37)23-10-5-2-6-11-23)26(34-31)22-16-14-21(15-17-22)13-12-20-8-3-1-4-9-20/h1,3-4,8-9,12-17,23-26,34H,2,5-7,10-11,18-19H2,(H,38,39)(H3,32,33,40) |
| InChIKey | AWPFEPSLQDKVDS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|