C25H25N5O9 — CID 3704013
1-(4-acetyloxyphenyl)-3-[3-(carbamoylamino)propyl]-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3704013) has the molecular formula C25H25N5O9 and a molecular weight of 539.50 g/mol. Its IUPAC name is 1-(4-acetyloxyphenyl)-3-[3-(carbamoylamino)propyl]-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(4-acetyloxyphenyl)-3-[3-(carbamoylamino)propyl]-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3704013 |
| Molecular Formula | C25H25N5O9 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 1-(4-acetyloxyphenyl)-3-[3-(carbamoylamino)propyl]-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(=O)Oc1ccc(C2NC(CCCNC(N)=O)(C(=O)O)C3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C23)cc1 |
| InChI | InChI=1S/C25H25N5O9/c1-13(31)39-17-8-6-14(7-9-17)20-18-19(25(28-20,23(34)35)10-3-11-27-24(26)36)22(33)29(21(18)32)15-4-2-5-16(12-15)30(37)38/h2,4-9,12,18-20,28H,3,10-11H2,1H3,(H,34,35)(H3,26,27,36) |
| InChIKey | FQANPYPDYUBLPY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 211.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|