C21H21N5O7S — CID 3708993
3-[3-(carbamoylamino)propyl]-5-(3-nitrophenyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3708993) has the molecular formula C21H21N5O7S and a molecular weight of 487.49 g/mol. Its IUPAC name is 3-[3-(carbamoylamino)propyl]-5-(3-nitrophenyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-[3-(carbamoylamino)propyl]-5-(3-nitrophenyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3708993 |
| Molecular Formula | C21H21N5O7S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 3-[3-(carbamoylamino)propyl]-5-(3-nitrophenyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | NC(=O)NCCCC1(C(=O)O)NC(c2cccs2)C2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)C21 |
| InChI | InChI=1S/C21H21N5O7S/c22-20(31)23-8-3-7-21(19(29)30)15-14(16(24-21)13-6-2-9-34-13)17(27)25(18(15)28)11-4-1-5-12(10-11)26(32)33/h1-2,4-6,9-10,14-16,24H,3,7-8H2,(H,29,30)(H3,22,23,31) |
| InChIKey | JKIGNIAOHQJAIH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|