C25H27ClN2O4S — CID 3713512
5-(3-chloro-4-methylphenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3713512) has the molecular formula C25H27ClN2O4S and a molecular weight of 487.02 g/mol. Its IUPAC name is 5-(3-chloro-4-methylphenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(3-chloro-4-methylphenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3713512 |
| Molecular Formula | C25H27ClN2O4S |
| Molecular Weight | 487.02 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 5-(3-chloro-4-methylphenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C3C(c4cccs4)NC(CC4CCCCC4)(C(=O)O)C3C2=O)cc1Cl |
| InChI | InChI=1S/C25H27ClN2O4S/c1-14-9-10-16(12-17(14)26)28-22(29)19-20(23(28)30)25(24(31)32,13-15-6-3-2-4-7-15)27-21(19)18-8-5-11-33-18/h5,8-12,15,19-21,27H,2-4,6-7,13H2,1H3,(H,31,32) |
| InChIKey | QWOKORCCOWLWAZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.02 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|