C29H31BrN2O6 — CID 5091908
5-(4-acetylphenyl)-1-(5-bromo-2-methoxyphenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5091908) has the molecular formula C29H31BrN2O6 and a molecular weight of 583.48 g/mol. Its IUPAC name is 5-(4-acetylphenyl)-1-(5-bromo-2-methoxyphenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(4-acetylphenyl)-1-(5-bromo-2-methoxyphenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5091908 |
| Molecular Formula | C29H31BrN2O6 |
| Molecular Weight | 583.48 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | 5-(4-acetylphenyl)-1-(5-bromo-2-methoxyphenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccc(Br)cc1C1NC(CC2CCCCC2)(C(=O)O)C2C(=O)N(c3ccc(C(C)=O)cc3)C(=O)C12 |
| InChI | InChI=1S/C29H31BrN2O6/c1-16(33)18-8-11-20(12-9-18)32-26(34)23-24(27(32)35)29(28(36)37,15-17-6-4-3-5-7-17)31-25(23)21-14-19(30)10-13-22(21)38-2/h8-14,17,23-25,31H,3-7,15H2,1-2H3,(H,36,37) |
| InChIKey | SNWUHPMVQHGEKI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|