C22H27BrN2O6 — CID 3751211
1-(5-bromo-2-methoxyphenyl)-5-cyclohexyl-3-(1-hydroxyethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3751211) has the molecular formula C22H27BrN2O6 and a molecular weight of 495.37 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-5-cyclohexyl-3-(1-hydroxyethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-5-cyclohexyl-3-(1-hydroxyethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3751211 |
| Molecular Formula | C22H27BrN2O6 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-5-cyclohexyl-3-(1-hydroxyethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccc(Br)cc1C1NC(C(=O)O)(C(C)O)C2C(=O)N(C3CCCCC3)C(=O)C12 |
| InChI | InChI=1S/C22H27BrN2O6/c1-11(26)22(21(29)30)17-16(18(24-22)14-10-12(23)8-9-15(14)31-2)19(27)25(20(17)28)13-6-4-3-5-7-13/h8-11,13,16-18,24,26H,3-7H2,1-2H3,(H,29,30) |
| InChIKey | WAZPJLXGGXBFNL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|