C21H19BrN2O5 — CID 3774427
3-benzyl-1-(5-bromo-2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3774427) has the molecular formula C21H19BrN2O5 and a molecular weight of 459.30 g/mol. Its IUPAC name is 3-benzyl-1-(5-bromo-2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-benzyl-1-(5-bromo-2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3774427 |
| Molecular Formula | C21H19BrN2O5 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 3-benzyl-1-(5-bromo-2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccc(Br)cc1C1NC(Cc2ccccc2)(C(=O)O)C2C(=O)NC(=O)C12 |
| InChI | InChI=1S/C21H19BrN2O5/c1-29-14-8-7-12(22)9-13(14)17-15-16(19(26)23-18(15)25)21(24-17,20(27)28)10-11-5-3-2-4-6-11/h2-9,15-17,24H,10H2,1H3,(H,27,28)(H,23,25,26) |
| InChIKey | XFHXCCNGVIHAGO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|