C27H22BrN3O7 — CID 4000294
3-benzyl-1-(4-bromophenyl)-5-(2-methoxy-4-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 4000294) has the molecular formula C27H22BrN3O7 and a molecular weight of 580.39 g/mol. Its IUPAC name is 3-benzyl-1-(4-bromophenyl)-5-(2-methoxy-4-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-benzyl-1-(4-bromophenyl)-5-(2-methoxy-4-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4000294 |
| Molecular Formula | C27H22BrN3O7 |
| Molecular Weight | 580.39 g/mol |
| Exact Mass | 579.06 |
| IUPAC Name | 3-benzyl-1-(4-bromophenyl)-5-(2-methoxy-4-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1N1C(=O)C2C(c3ccc(Br)cc3)NC(Cc3ccccc3)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C27H22BrN3O7/c1-38-20-13-18(31(36)37)11-12-19(20)30-24(32)21-22(25(30)33)27(26(34)35,14-15-5-3-2-4-6-15)29-23(21)16-7-9-17(28)10-8-16/h2-13,21-23,29H,14H2,1H3,(H,34,35) |
| InChIKey | RVEZGEZXPLTWRA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|