C25H21N3O7S — CID 100880594
(1R,3S,3aR,6aS)-3-benzyl-5-(4-methoxy-2-nitrophenyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 100880594) has the molecular formula C25H21N3O7S and a molecular weight of 507.52 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-3-benzyl-5-(4-methoxy-2-nitrophenyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | (1R,3S,3aR,6aS)-3-benzyl-5-(4-methoxy-2-nitrophenyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 100880594 |
| Molecular Formula | C25H21N3O7S |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | (1R,3S,3aR,6aS)-3-benzyl-5-(4-methoxy-2-nitrophenyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@@H](C2=O)[C@@](Cc2ccccc2)(C(=O)O)N[C@H]3c2cccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H21N3O7S/c1-35-15-9-10-16(17(12-15)28(33)34)27-22(29)19-20(23(27)30)25(24(31)32,13-14-6-3-2-4-7-14)26-21(19)18-8-5-11-36-18/h2-12,19-21,26H,13H2,1H3,(H,31,32)/t19-,20-,21-,25-/m0/s1 |
| InChIKey | SFMPFJBFGZEVHC-UKDJSQQHSA-N |
| XLogP | 3.18 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|