C27H23FN2O5 — CID 98091373
(1R,3R,3aR,6aS)-3-benzyl-1-(4-fluorophenyl)-5-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 98091373) has the molecular formula C27H23FN2O5 and a molecular weight of 474.49 g/mol. Its IUPAC name is (1R,3R,3aR,6aS)-3-benzyl-1-(4-fluorophenyl)-5-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | (1R,3R,3aR,6aS)-3-benzyl-1-(4-fluorophenyl)-5-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 98091373 |
| Molecular Formula | C27H23FN2O5 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (1R,3R,3aR,6aS)-3-benzyl-1-(4-fluorophenyl)-5-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccccc1N1C(=O)[C@H]2[C@@H](C1=O)[C@](Cc1ccccc1)(C(=O)O)N[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C27H23FN2O5/c1-35-20-10-6-5-9-19(20)30-24(31)21-22(25(30)32)27(26(33)34,15-16-7-3-2-4-8-16)29-23(21)17-11-13-18(28)14-12-17/h2-14,21-23,29H,15H2,1H3,(H,33,34)/t21-,22-,23-,27+/m0/s1 |
| InChIKey | UJLNTOMQKVXDSD-RNLGNXJRSA-N |
| XLogP | 3.35 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|