C34H28N4O10 — CID 3667108
1-(3-methoxy-2-phenylmethoxyphenyl)-5-(3-nitrophenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3667108) has the molecular formula C34H28N4O10 and a molecular weight of 652.62 g/mol. Its IUPAC name is 1-(3-methoxy-2-phenylmethoxyphenyl)-5-(3-nitrophenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(3-methoxy-2-phenylmethoxyphenyl)-5-(3-nitrophenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3667108 |
| Molecular Formula | C34H28N4O10 |
| Molecular Weight | 652.62 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | 1-(3-methoxy-2-phenylmethoxyphenyl)-5-(3-nitrophenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cccc(C2NC(Cc3ccc([N+](=O)[O-])cc3)(C(=O)O)C3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C23)c1OCc1ccccc1 |
| InChI | InChI=1S/C34H28N4O10/c1-47-26-12-6-11-25(30(26)48-19-21-7-3-2-4-8-21)29-27-28(32(40)36(31(27)39)23-9-5-10-24(17-23)38(45)46)34(35-29,33(41)42)18-20-13-15-22(16-14-20)37(43)44/h2-17,27-29,35H,18-19H2,1H3,(H,41,42) |
| InChIKey | IDAISEWIJMOJTQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 191.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|