C29H27N3O9 — CID 3749696
3-(1-hydroxyethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3749696) has the molecular formula C29H27N3O9 and a molecular weight of 561.55 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(1-hydroxyethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3749696 |
| Molecular Formula | C29H27N3O9 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 3-(1-hydroxyethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cccc(C2NC(C(=O)O)(C(C)O)C3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C23)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H27N3O9/c1-16(33)29(28(36)37)23-22(26(34)31(27(23)35)18-10-6-11-19(14-18)32(38)39)24(30-29)20-12-7-13-21(40-2)25(20)41-15-17-8-4-3-5-9-17/h3-14,16,22-24,30,33H,15H2,1-2H3,(H,36,37) |
| InChIKey | PKOBEYFPGOUGOA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 168.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|