C21H19N3O8 — CID 3815855
1-(4-hydroxy-3-methoxyphenyl)-3-methyl-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3815855) has the molecular formula C21H19N3O8 and a molecular weight of 441.40 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxyphenyl)-3-methyl-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(4-hydroxy-3-methoxyphenyl)-3-methyl-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3815855 |
| Molecular Formula | C21H19N3O8 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)-3-methyl-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cc(C2NC(C)(C(=O)O)C3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C23)ccc1O |
| InChI | InChI=1S/C21H19N3O8/c1-21(20(28)29)16-15(17(22-21)10-6-7-13(25)14(8-10)32-2)18(26)23(19(16)27)11-4-3-5-12(9-11)24(30)31/h3-9,15-17,22,25H,1-2H3,(H,28,29) |
| InChIKey | SLWFNFFJFRCKED-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 159.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|