C25H28N2O7 — CID 124765387
ethyl (1S,3R,3aR,6aR)-1-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 124765387) has the molecular formula C25H28N2O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is ethyl (1S,3R,3aR,6aR)-1-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (1S,3R,3aR,6aR)-1-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 124765387 |
| Molecular Formula | C25H28N2O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | ethyl (1S,3R,3aR,6aR)-1-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)N[C@H](c2ccc(OC)c(OC)c2)[C@@H]2C(=O)N(c3cccc(OC)c3)C(=O)[C@H]21 |
| InChI | InChI=1S/C25H28N2O7/c1-6-34-24(30)25(2)20-19(21(26-25)14-10-11-17(32-4)18(12-14)33-5)22(28)27(23(20)29)15-8-7-9-16(13-15)31-3/h7-13,19-21,26H,6H2,1-5H3/t19-,20+,21-,25-/m1/s1 |
| InChIKey | DEMOEFKEPNYAHE-FBROZUCGSA-N |
| XLogP | 2.48 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|