C26H30N2O5 — CID 25409535
ethyl (1R,3S,3aS,6aS)-5-(4-methoxyphenyl)-3-methyl-4,6-dioxo-1-(4-propan-2-ylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 25409535) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is ethyl (1R,3S,3aS,6aS)-5-(4-methoxyphenyl)-3-methyl-4,6-dioxo-1-(4-propan-2-ylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (1R,3S,3aS,6aS)-5-(4-methoxyphenyl)-3-methyl-4,6-dioxo-1-(4-propan-2-ylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 25409535 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | ethyl (1R,3S,3aS,6aS)-5-(4-methoxyphenyl)-3-methyl-4,6-dioxo-1-(4-propan-2-ylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)N[C@@H](c2ccc(C(C)C)cc2)[C@H]2C(=O)N(c3ccc(OC)cc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C26H30N2O5/c1-6-33-25(31)26(4)21-20(22(27-26)17-9-7-16(8-10-17)15(2)3)23(29)28(24(21)30)18-11-13-19(32-5)14-12-18/h7-15,20-22,27H,6H2,1-5H3/t20-,21+,22-,26-/m0/s1 |
| InChIKey | UEEXJQRKSQZHIF-MSZDEVHKSA-N |
| XLogP | 3.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|