C25H19N3O7 — CID 3843885
1-(2-hydroxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3843885) has the molecular formula C25H19N3O7 and a molecular weight of 473.44 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(2-hydroxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3843885 |
| Molecular Formula | C25H19N3O7 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 1-(2-hydroxyphenyl)-5-(3-nitrophenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3ccccc3O)NC(C(=O)O)(c3ccccc3)C2C(=O)N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H19N3O7/c29-18-12-5-4-11-17(18)21-19-20(25(26-21,24(32)33)14-7-2-1-3-8-14)23(31)27(22(19)30)15-9-6-10-16(13-15)28(34)35/h1-13,19-21,26,29H,(H,32,33) |
| InChIKey | VMCLZYZUWUAZDP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|