C26H21N3O6 — CID 3830941
1-(2-methylphenyl)-5-(3-nitrophenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3830941) has the molecular formula C26H21N3O6 and a molecular weight of 471.47 g/mol. Its IUPAC name is 1-(2-methylphenyl)-5-(3-nitrophenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(2-methylphenyl)-5-(3-nitrophenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3830941 |
| Molecular Formula | C26H21N3O6 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1-(2-methylphenyl)-5-(3-nitrophenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccccc1C1NC(C(=O)O)(c2ccccc2)C2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)C12 |
| InChI | InChI=1S/C26H21N3O6/c1-15-8-5-6-13-19(15)22-20-21(26(27-22,25(32)33)16-9-3-2-4-10-16)24(31)28(23(20)30)17-11-7-12-18(14-17)29(34)35/h2-14,20-22,27H,1H3,(H,32,33) |
| InChIKey | DVRUBLJKQDVJAM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|