C26H18Cl4N2O4 — CID 3833385
5-(3-chloro-4-methylphenyl)-4,6-dioxo-3-phenyl-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3833385) has the molecular formula C26H18Cl4N2O4 and a molecular weight of 564.25 g/mol. Its IUPAC name is 5-(3-chloro-4-methylphenyl)-4,6-dioxo-3-phenyl-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(3-chloro-4-methylphenyl)-4,6-dioxo-3-phenyl-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3833385 |
| Molecular Formula | C26H18Cl4N2O4 |
| Molecular Weight | 564.25 g/mol |
| Exact Mass | 562.00 |
| IUPAC Name | 5-(3-chloro-4-methylphenyl)-4,6-dioxo-3-phenyl-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C3C(c4cc(Cl)cc(Cl)c4Cl)NC(C(=O)O)(c4ccccc4)C3C2=O)cc1Cl |
| InChI | InChI=1S/C26H18Cl4N2O4/c1-12-7-8-15(11-17(12)28)32-23(33)19-20(24(32)34)26(25(35)36,13-5-3-2-4-6-13)31-22(19)16-9-14(27)10-18(29)21(16)30/h2-11,19-20,22,31H,1H3,(H,35,36) |
| InChIKey | JBZNCYKCKVUBCW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.25 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|