C21H16Cl4N2O5 — CID 3703939
5-(3-chloro-4-methylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3703939) has the molecular formula C21H16Cl4N2O5 and a molecular weight of 518.18 g/mol. Its IUPAC name is 5-(3-chloro-4-methylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(3-chloro-4-methylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3703939 |
| Molecular Formula | C21H16Cl4N2O5 |
| Molecular Weight | 518.18 g/mol |
| Exact Mass | 515.98 |
| IUPAC Name | 5-(3-chloro-4-methylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C3C(c4cc(Cl)cc(Cl)c4Cl)NC(CO)(C(=O)O)C3C2=O)cc1Cl |
| InChI | InChI=1S/C21H16Cl4N2O5/c1-8-2-3-10(6-12(8)23)27-18(29)14-15(19(27)30)21(7-28,20(31)32)26-17(14)11-4-9(22)5-13(24)16(11)25/h2-6,14-15,17,26,28H,7H2,1H3,(H,31,32) |
| InChIKey | WINMHRITFIPIFM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.18 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|