C25H23Cl3N2O6 — CID 3724328
3-(carboxymethyl)-5-(2,6-diethylphenyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3724328) has the molecular formula C25H23Cl3N2O6 and a molecular weight of 553.83 g/mol. Its IUPAC name is 3-(carboxymethyl)-5-(2,6-diethylphenyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-5-(2,6-diethylphenyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3724328 |
| Molecular Formula | C25H23Cl3N2O6 |
| Molecular Weight | 553.83 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | 3-(carboxymethyl)-5-(2,6-diethylphenyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1cccc(CC)c1N1C(=O)C2C(c3cc(Cl)cc(Cl)c3Cl)NC(CC(=O)O)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C25H23Cl3N2O6/c1-3-11-6-5-7-12(4-2)21(11)30-22(33)17-18(23(30)34)25(24(35)36,10-16(31)32)29-20(17)14-8-13(26)9-15(27)19(14)28/h5-9,17-18,20,29H,3-4,10H2,1-2H3,(H,31,32)(H,35,36) |
| InChIKey | CQXHTHGYBCUYHE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|