C22H23ClN2O5S — CID 5020500
1-(5-chlorothiophen-2-yl)-5-(2,6-diethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5020500) has the molecular formula C22H23ClN2O5S and a molecular weight of 462.96 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-5-(2,6-diethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(5-chlorothiophen-2-yl)-5-(2,6-diethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5020500 |
| Molecular Formula | C22H23ClN2O5S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-5-(2,6-diethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1cccc(CC)c1N1C(=O)C2C(c3ccc(Cl)s3)NC(CO)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C22H23ClN2O5S/c1-3-11-6-5-7-12(4-2)18(11)25-19(27)15-16(20(25)28)22(10-26,21(29)30)24-17(15)13-8-9-14(23)31-13/h5-9,15-17,24,26H,3-4,10H2,1-2H3,(H,29,30) |
| InChIKey | YFQIZPJCIGDMQD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|