C31H29F3N2O6 — CID 5012070
5-(2,6-diethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5012070) has the molecular formula C31H29F3N2O6 and a molecular weight of 582.58 g/mol. Its IUPAC name is 5-(2,6-diethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2,6-diethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5012070 |
| Molecular Formula | C31H29F3N2O6 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | 5-(2,6-diethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1cccc(CC)c1N1C(=O)C2C(c3cccc(Oc4cccc(C(F)(F)F)c4)c3)NC(CO)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C31H29F3N2O6/c1-3-17-8-5-9-18(4-2)26(17)36-27(38)23-24(28(36)39)30(16-37,29(40)41)35-25(23)19-10-6-12-21(14-19)42-22-13-7-11-20(15-22)31(32,33)34/h5-15,23-25,35,37H,3-4,16H2,1-2H3,(H,40,41) |
| InChIKey | SGIXHERIMUXYBG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|