C28H23F3N2O5 — CID 3851294
3-methyl-5-(2-methylphenyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3851294) has the molecular formula C28H23F3N2O5 and a molecular weight of 524.50 g/mol. Its IUPAC name is 3-methyl-5-(2-methylphenyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-methyl-5-(2-methylphenyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3851294 |
| Molecular Formula | C28H23F3N2O5 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 3-methyl-5-(2-methylphenyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccccc1N1C(=O)C2C(c3cccc(Oc4cccc(C(F)(F)F)c4)c3)NC(C)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C28H23F3N2O5/c1-15-7-3-4-12-20(15)33-24(34)21-22(25(33)35)27(2,26(36)37)32-23(21)16-8-5-10-18(13-16)38-19-11-6-9-17(14-19)28(29,30)31/h3-14,21-23,32H,1-2H3,(H,36,37) |
| InChIKey | LSPUYHRJHPKXHW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|