C29H22ClF3N2O7 — CID 3513460
3-(carboxymethyl)-5-(3-chloro-4-methylphenyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3513460) has the molecular formula C29H22ClF3N2O7 and a molecular weight of 602.95 g/mol. Its IUPAC name is 3-(carboxymethyl)-5-(3-chloro-4-methylphenyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-5-(3-chloro-4-methylphenyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3513460 |
| Molecular Formula | C29H22ClF3N2O7 |
| Molecular Weight | 602.95 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | 3-(carboxymethyl)-5-(3-chloro-4-methylphenyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C3C(c4cccc(Oc5cccc(C(F)(F)F)c5)c4)NC(CC(=O)O)(C(=O)O)C3C2=O)cc1Cl |
| InChI | InChI=1S/C29H22ClF3N2O7/c1-14-8-9-17(12-20(14)30)35-25(38)22-23(26(35)39)28(27(40)41,13-21(36)37)34-24(22)15-4-2-6-18(10-15)42-19-7-3-5-16(11-19)29(31,32)33/h2-12,22-24,34H,13H2,1H3,(H,36,37)(H,40,41) |
| InChIKey | SETJOTKVZJEDSV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.95 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|