C34H26F3N3O7 — CID 3673309
5-benzyl-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3673309) has the molecular formula C34H26F3N3O7 and a molecular weight of 645.59 g/mol. Its IUPAC name is 5-benzyl-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3673309 |
| Molecular Formula | C34H26F3N3O7 |
| Molecular Weight | 645.59 g/mol |
| Exact Mass | 645.17 |
| IUPAC Name | 5-benzyl-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3cccc(Oc4cccc(C(F)(F)F)c4)c3)NC(Cc3ccc([N+](=O)[O-])cc3)(C(=O)O)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C34H26F3N3O7/c35-34(36,37)23-9-5-11-26(17-23)47-25-10-4-8-22(16-25)29-27-28(31(42)39(30(27)41)19-21-6-2-1-3-7-21)33(38-29,32(43)44)18-20-12-14-24(15-13-20)40(45)46/h1-17,27-29,38H,18-19H2,(H,43,44) |
| InChIKey | AQJHRFXGIGUHCK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|