C28H25N3O8 — CID 3706732
5-(2-hydroxyethyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3706732) has the molecular formula C28H25N3O8 and a molecular weight of 531.52 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2-hydroxyethyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3706732 |
| Molecular Formula | C28H25N3O8 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 5-(2-hydroxyethyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3ccc(Oc4ccccc4)cc3)NC(Cc3ccc([N+](=O)[O-])cc3)(C(=O)O)C2C(=O)N1CCO |
| InChI | InChI=1S/C28H25N3O8/c32-15-14-30-25(33)22-23(26(30)34)28(27(35)36,16-17-6-10-19(11-7-17)31(37)38)29-24(22)18-8-12-21(13-9-18)39-20-4-2-1-3-5-20/h1-13,22-24,29,32H,14-16H2,(H,35,36) |
| InChIKey | VIQUSZJWHWMAMI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 159.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|