C36H26N2O9 — CID 3734881
3-(carboxymethyl)-5-[(9,10-dioxoanthracen-2-yl)methyl]-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3734881) has the molecular formula C36H26N2O9 and a molecular weight of 630.61 g/mol. Its IUPAC name is 3-(carboxymethyl)-5-[(9,10-dioxoanthracen-2-yl)methyl]-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-5-[(9,10-dioxoanthracen-2-yl)methyl]-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3734881 |
| Molecular Formula | C36H26N2O9 |
| Molecular Weight | 630.61 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | 3-(carboxymethyl)-5-[(9,10-dioxoanthracen-2-yl)methyl]-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)CC1(C(=O)O)NC(c2ccc(Oc3ccccc3)cc2)C2C(=O)N(Cc3ccc4c(c3)C(=O)c3ccccc3C4=O)C(=O)C21 |
| InChI | InChI=1S/C36H26N2O9/c39-27(40)17-36(35(45)46)29-28(30(37-36)20-11-13-22(14-12-20)47-21-6-2-1-3-7-21)33(43)38(34(29)44)18-19-10-15-25-26(16-19)32(42)24-9-5-4-8-23(24)31(25)41/h1-16,28-30,37H,17-18H2,(H,39,40)(H,45,46) |
| InChIKey | QKNFDVNAJGYWSU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|