C25H24N2O7 — CID 3870739
5-but-2-enyl-3-(carboxymethyl)-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3870739) has the molecular formula C25H24N2O7 and a molecular weight of 464.47 g/mol. Its IUPAC name is 5-but-2-enyl-3-(carboxymethyl)-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-but-2-enyl-3-(carboxymethyl)-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3870739 |
| Molecular Formula | C25H24N2O7 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 5-but-2-enyl-3-(carboxymethyl)-4,6-dioxo-1-(4-phenoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC=CCN1C(=O)C2C(c3ccc(Oc4ccccc4)cc3)NC(CC(=O)O)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C25H24N2O7/c1-2-3-13-27-22(30)19-20(23(27)31)25(24(32)33,14-18(28)29)26-21(19)15-9-11-17(12-10-15)34-16-7-5-4-6-8-16/h2-12,19-21,26H,13-14H2,1H3,(H,28,29)(H,32,33) |
| InChIKey | ZAGFSJDVMBTXBO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|