C24H22F3N3O7 — CID 3871654
5-(2-anilinoethyl)-3-(carboxymethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3871654) has the molecular formula C24H22F3N3O7 and a molecular weight of 521.45 g/mol. Its IUPAC name is 5-(2-anilinoethyl)-3-(carboxymethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2-anilinoethyl)-3-(carboxymethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3871654 |
| Molecular Formula | C24H22F3N3O7 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 5-(2-anilinoethyl)-3-(carboxymethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)CC1(C(=O)O)NC(c2cccc(OC(F)(F)F)c2)C2C(=O)N(CCNc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C24H22F3N3O7/c25-24(26,27)37-15-8-4-5-13(11-15)19-17-18(23(29-19,22(35)36)12-16(31)32)21(34)30(20(17)33)10-9-28-14-6-2-1-3-7-14/h1-8,11,17-19,28-29H,9-10,12H2,(H,31,32)(H,35,36) |
| InChIKey | SWSQPWXFSGQNJE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|