C32H25F3N2O7S — CID 3863395
5-[(9,10-dioxoanthracen-2-yl)methyl]-3-(2-methylsulfanylethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3863395) has the molecular formula C32H25F3N2O7S and a molecular weight of 638.62 g/mol. Its IUPAC name is 5-[(9,10-dioxoanthracen-2-yl)methyl]-3-(2-methylsulfanylethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-[(9,10-dioxoanthracen-2-yl)methyl]-3-(2-methylsulfanylethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3863395 |
| Molecular Formula | C32H25F3N2O7S |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 638.13 |
| IUPAC Name | 5-[(9,10-dioxoanthracen-2-yl)methyl]-3-(2-methylsulfanylethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CSCCC1(C(=O)O)NC(c2cccc(OC(F)(F)F)c2)C2C(=O)N(Cc3ccc4c(c3)C(=O)c3ccccc3C4=O)C(=O)C21 |
| InChI | InChI=1S/C32H25F3N2O7S/c1-45-12-11-31(30(42)43)24-23(25(36-31)17-5-4-6-18(14-17)44-32(33,34)35)28(40)37(29(24)41)15-16-9-10-21-22(13-16)27(39)20-8-3-2-7-19(20)26(21)38/h2-10,13-14,23-25,36H,11-12,15H2,1H3,(H,42,43) |
| InChIKey | VUWIJPFWNXXWQO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|