C23H19F3N2O7 — CID 3560306
5-(4-acetylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3560306) has the molecular formula C23H19F3N2O7 and a molecular weight of 492.41 g/mol. Its IUPAC name is 5-(4-acetylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(4-acetylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3560306 |
| Molecular Formula | C23H19F3N2O7 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 5-(4-acetylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(=O)c1ccc(N2C(=O)C3C(c4cccc(OC(F)(F)F)c4)NC(CO)(C(=O)O)C3C2=O)cc1 |
| InChI | InChI=1S/C23H19F3N2O7/c1-11(30)12-5-7-14(8-6-12)28-19(31)16-17(20(28)32)22(10-29,21(33)34)27-18(16)13-3-2-4-15(9-13)35-23(24,25)26/h2-9,16-18,27,29H,10H2,1H3,(H,33,34) |
| InChIKey | ACUNGLOUSPZQEM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|