C22H19F3N2O5 — CID 4996692
3-(hydroxymethyl)-5-(2-methylphenyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 4996692) has the molecular formula C22H19F3N2O5 and a molecular weight of 448.40 g/mol. Its IUPAC name is 3-(hydroxymethyl)-5-(2-methylphenyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(hydroxymethyl)-5-(2-methylphenyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4996692 |
| Molecular Formula | C22H19F3N2O5 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-(hydroxymethyl)-5-(2-methylphenyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccccc1N1C(=O)C2C(c3cccc(C(F)(F)F)c3)NC(CO)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C22H19F3N2O5/c1-11-5-2-3-8-14(11)27-18(29)15-16(19(27)30)21(10-28,20(31)32)26-17(15)12-6-4-7-13(9-12)22(23,24)25/h2-9,15-17,26,28H,10H2,1H3,(H,31,32) |
| InChIKey | VTBPYJDXLBQVMM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|