C27H26F3N3O4 — CID 3282945
5-butyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3282945) has the molecular formula C27H26F3N3O4 and a molecular weight of 513.52 g/mol. Its IUPAC name is 5-butyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-butyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3282945 |
| Molecular Formula | C27H26F3N3O4 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 5-butyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCCCN1C(=O)C2C(c3cccc(C(F)(F)F)c3)NC(Cc3c[nH]c4ccccc34)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C27H26F3N3O4/c1-2-3-11-33-23(34)20-21(24(33)35)26(25(36)37,13-16-14-31-19-10-5-4-9-18(16)19)32-22(20)15-7-6-8-17(12-15)27(28,29)30/h4-10,12,14,20-22,31-32H,2-3,11,13H2,1H3,(H,36,37) |
| InChIKey | VJDCADADHOWJHH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|