C33H27N3O4 — CID 3759465
3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-prop-2-ynyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3759465) has the molecular formula C33H27N3O4 and a molecular weight of 529.60 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-prop-2-ynyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-prop-2-ynyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3759465 |
| Molecular Formula | C33H27N3O4 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-prop-2-ynyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | C#CCN1C(=O)C2C(c3ccc(C=Cc4ccccc4)cc3)NC(Cc3c[nH]c4ccccc34)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C33H27N3O4/c1-2-18-36-30(37)27-28(31(36)38)33(32(39)40,19-24-20-34-26-11-7-6-10-25(24)26)35-29(27)23-16-14-22(15-17-23)13-12-21-8-4-3-5-9-21/h1,3-17,20,27-29,34-35H,18-19H2,(H,39,40) |
| InChIKey | SZAPTMRJQSLYAD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|