C33H39N3O5 — CID 5165316
3-(1H-indol-3-ylmethyl)-5-oct-3-enyl-4,6-dioxo-1-(4-propoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5165316) has the molecular formula C33H39N3O5 and a molecular weight of 557.69 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethyl)-5-oct-3-enyl-4,6-dioxo-1-(4-propoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(1H-indol-3-ylmethyl)-5-oct-3-enyl-4,6-dioxo-1-(4-propoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5165316 |
| Molecular Formula | C33H39N3O5 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | 3-(1H-indol-3-ylmethyl)-5-oct-3-enyl-4,6-dioxo-1-(4-propoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCCCC=CCCN1C(=O)C2C(c3ccc(OCCC)cc3)NC(Cc3c[nH]c4ccccc34)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C33H39N3O5/c1-3-5-6-7-8-11-18-36-30(37)27-28(31(36)38)33(32(39)40,20-23-21-34-26-13-10-9-12-25(23)26)35-29(27)22-14-16-24(17-15-22)41-19-4-2/h7-10,12-17,21,27-29,34-35H,3-6,11,18-20H2,1-2H3,(H,39,40) |
| InChIKey | JAVMIUHINNNTQH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|