C28H30BrN3O6 — CID 4600395
1-(3-bromo-4,5-dimethoxyphenyl)-5-butyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 4600395) has the molecular formula C28H30BrN3O6 and a molecular weight of 584.47 g/mol. Its IUPAC name is 1-(3-bromo-4,5-dimethoxyphenyl)-5-butyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(3-bromo-4,5-dimethoxyphenyl)-5-butyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4600395 |
| Molecular Formula | C28H30BrN3O6 |
| Molecular Weight | 584.47 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | 1-(3-bromo-4,5-dimethoxyphenyl)-5-butyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCCCN1C(=O)C2C(c3cc(Br)c(OC)c(OC)c3)NC(Cc3c[nH]c4ccccc34)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C28H30BrN3O6/c1-4-5-10-32-25(33)21-22(26(32)34)28(27(35)36,13-16-14-30-19-9-7-6-8-17(16)19)31-23(21)15-11-18(29)24(38-3)20(12-15)37-2/h6-9,11-12,14,21-23,30-31H,4-5,10,13H2,1-3H3,(H,35,36) |
| InChIKey | WKRAXADOPHHAHW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|