C27H28N2O7 — CID 3871261
3-(carboxymethyl)-4,6-dioxo-5-(3-phenylprop-2-enyl)-1-(4-propoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3871261) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is 3-(carboxymethyl)-4,6-dioxo-5-(3-phenylprop-2-enyl)-1-(4-propoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-4,6-dioxo-5-(3-phenylprop-2-enyl)-1-(4-propoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3871261 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 3-(carboxymethyl)-4,6-dioxo-5-(3-phenylprop-2-enyl)-1-(4-propoxyphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCCOc1ccc(C2NC(CC(=O)O)(C(=O)O)C3C(=O)N(CC=Cc4ccccc4)C(=O)C23)cc1 |
| InChI | InChI=1S/C27H28N2O7/c1-2-15-36-19-12-10-18(11-13-19)23-21-22(27(28-23,26(34)35)16-20(30)31)25(33)29(24(21)32)14-6-9-17-7-4-3-5-8-17/h3-13,21-23,28H,2,14-16H2,1H3,(H,30,31)(H,34,35) |
| InChIKey | FRCPGDWMPJVZJQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|