C36H30N4O4 — CID 3756604
3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-(pyridin-2-ylmethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3756604) has the molecular formula C36H30N4O4 and a molecular weight of 582.66 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-(pyridin-2-ylmethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-(pyridin-2-ylmethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3756604 |
| Molecular Formula | C36H30N4O4 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | 3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-(pyridin-2-ylmethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3ccc(C=Cc4ccccc4)cc3)NC(Cc3c[nH]c4ccccc34)(C(=O)O)C2C(=O)N1Cc1ccccn1 |
| InChI | InChI=1S/C36H30N4O4/c41-33-30-31(34(42)40(33)22-27-10-6-7-19-37-27)36(35(43)44,20-26-21-38-29-12-5-4-11-28(26)29)39-32(30)25-17-15-24(16-18-25)14-13-23-8-2-1-3-9-23/h1-19,21,30-32,38-39H,20,22H2,(H,43,44) |
| InChIKey | CNIMWVZUJPAJSB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|