C31H25ClN4O6 — CID 3413703
1-(5-chloro-2-nitrophenyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-5-(3-phenylprop-2-enyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3413703) has the molecular formula C31H25ClN4O6 and a molecular weight of 585.02 g/mol. Its IUPAC name is 1-(5-chloro-2-nitrophenyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-5-(3-phenylprop-2-enyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(5-chloro-2-nitrophenyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-5-(3-phenylprop-2-enyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3413703 |
| Molecular Formula | C31H25ClN4O6 |
| Molecular Weight | 585.02 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | 1-(5-chloro-2-nitrophenyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-5-(3-phenylprop-2-enyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3cc(Cl)ccc3[N+](=O)[O-])NC(Cc3c[nH]c4ccccc34)(C(=O)O)C2C(=O)N1CC=Cc1ccccc1 |
| InChI | InChI=1S/C31H25ClN4O6/c32-20-12-13-24(36(41)42)22(15-20)27-25-26(29(38)35(28(25)37)14-6-9-18-7-2-1-3-8-18)31(34-27,30(39)40)16-19-17-33-23-11-5-4-10-21(19)23/h1-13,15,17,25-27,33-34H,14,16H2,(H,39,40) |
| InChIKey | IPYTUJKHYPPMGV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 145.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.02 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|