C30H25Cl3N4O4 — CID 5155541
5-(2-anilinoethyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5155541) has the molecular formula C30H25Cl3N4O4 and a molecular weight of 611.91 g/mol. Its IUPAC name is 5-(2-anilinoethyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2-anilinoethyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5155541 |
| Molecular Formula | C30H25Cl3N4O4 |
| Molecular Weight | 611.91 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | 5-(2-anilinoethyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3cc(Cl)cc(Cl)c3Cl)NC(Cc3c[nH]c4ccccc34)(C(=O)O)C2C(=O)N1CCNc1ccccc1 |
| InChI | InChI=1S/C30H25Cl3N4O4/c31-17-12-20(25(33)21(32)13-17)26-23-24(28(39)37(27(23)38)11-10-34-18-6-2-1-3-7-18)30(36-26,29(40)41)14-16-15-35-22-9-5-4-8-19(16)22/h1-9,12-13,15,23-24,26,34-36H,10-11,14H2,(H,40,41) |
| InChIKey | XPLXSOUOFVDBBN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.91 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|