C30H30N4O5 — CID 3701783
5-(2-anilinoethyl)-1-(4,5-dimethylfuran-2-yl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3701783) has the molecular formula C30H30N4O5 and a molecular weight of 526.59 g/mol. Its IUPAC name is 5-(2-anilinoethyl)-1-(4,5-dimethylfuran-2-yl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2-anilinoethyl)-1-(4,5-dimethylfuran-2-yl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3701783 |
| Molecular Formula | C30H30N4O5 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 5-(2-anilinoethyl)-1-(4,5-dimethylfuran-2-yl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1cc(C2NC(Cc3c[nH]c4ccccc34)(C(=O)O)C3C(=O)N(CCNc4ccccc4)C(=O)C23)oc1C |
| InChI | InChI=1S/C30H30N4O5/c1-17-14-23(39-18(17)2)26-24-25(28(36)34(27(24)35)13-12-31-20-8-4-3-5-9-20)30(33-26,29(37)38)15-19-16-32-22-11-7-6-10-21(19)22/h3-11,14,16,24-26,31-33H,12-13,15H2,1-2H3,(H,37,38) |
| InChIKey | PQIDYGMMSTYURI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|