C30H29N3O5 — CID 3564458
1-(1-benzofuran-2-yl)-5-cyclohexyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3564458) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-5-cyclohexyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(1-benzofuran-2-yl)-5-cyclohexyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3564458 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-5-cyclohexyl-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3cc4ccccc4o3)NC(Cc3c[nH]c4ccccc34)(C(=O)O)C2C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C30H29N3O5/c34-27-24-25(28(35)33(27)19-9-2-1-3-10-19)30(29(36)37,15-18-16-31-21-12-6-5-11-20(18)21)32-26(24)23-14-17-8-4-7-13-22(17)38-23/h4-8,11-14,16,19,24-26,31-32H,1-3,9-10,15H2,(H,36,37) |
| InChIKey | LGDDCVFRRDSPQW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|