C27H21Cl3N2O4 — CID 3770892
3,5-dibenzyl-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3770892) has the molecular formula C27H21Cl3N2O4 and a molecular weight of 543.83 g/mol. Its IUPAC name is 3,5-dibenzyl-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3,5-dibenzyl-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3770892 |
| Molecular Formula | C27H21Cl3N2O4 |
| Molecular Weight | 543.83 g/mol |
| Exact Mass | 542.06 |
| IUPAC Name | 3,5-dibenzyl-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3cc(Cl)cc(Cl)c3Cl)NC(Cc3ccccc3)(C(=O)O)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H21Cl3N2O4/c28-17-11-18(22(30)19(29)12-17)23-20-21(25(34)32(24(20)33)14-16-9-5-2-6-10-16)27(31-23,26(35)36)13-15-7-3-1-4-8-15/h1-12,20-21,23,31H,13-14H2,(H,35,36) |
| InChIKey | KVLYDHUKOLXUEW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.83 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|