C24H24Cl2N2O5 — CID 4165550
5-benzyl-1-(3,5-dichloro-2-hydroxyphenyl)-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 4165550) has the molecular formula C24H24Cl2N2O5 and a molecular weight of 491.37 g/mol. Its IUPAC name is 5-benzyl-1-(3,5-dichloro-2-hydroxyphenyl)-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-1-(3,5-dichloro-2-hydroxyphenyl)-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4165550 |
| Molecular Formula | C24H24Cl2N2O5 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 5-benzyl-1-(3,5-dichloro-2-hydroxyphenyl)-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)CC1(C(=O)O)NC(c2cc(Cl)cc(Cl)c2O)C2C(=O)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C24H24Cl2N2O5/c1-12(2)10-24(23(32)33)18-17(19(27-24)15-8-14(25)9-16(26)20(15)29)21(30)28(22(18)31)11-13-6-4-3-5-7-13/h3-9,12,17-19,27,29H,10-11H2,1-2H3,(H,32,33) |
| InChIKey | FNMUJZMCLRXZHS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|