C23H21Cl3N2O5 — CID 26501351
(1S,3S,3aS,6aS)-5-(3-chlorophenyl)-1-(3,5-dichloro-2-hydroxyphenyl)-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 26501351) has the molecular formula C23H21Cl3N2O5 and a molecular weight of 511.79 g/mol. Its IUPAC name is (1S,3S,3aS,6aS)-5-(3-chlorophenyl)-1-(3,5-dichloro-2-hydroxyphenyl)-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | (1S,3S,3aS,6aS)-5-(3-chlorophenyl)-1-(3,5-dichloro-2-hydroxyphenyl)-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 26501351 |
| Molecular Formula | C23H21Cl3N2O5 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | (1S,3S,3aS,6aS)-5-(3-chlorophenyl)-1-(3,5-dichloro-2-hydroxyphenyl)-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)C[C@]1(C(=O)O)N[C@H](c2cc(Cl)cc(Cl)c2O)[C@H]2C(=O)N(c3cccc(Cl)c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C23H21Cl3N2O5/c1-10(2)9-23(22(32)33)17-16(18(27-23)14-7-12(25)8-15(26)19(14)29)20(30)28(21(17)31)13-5-3-4-11(24)6-13/h3-8,10,16-18,27,29H,9H2,1-2H3,(H,32,33)/t16-,17+,18+,23-/m0/s1 |
| InChIKey | QBRSUGNGRHYXKU-JFNLIGNMSA-N |
| XLogP | 4.67 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|