C28H21Cl3N2O6 — CID 4989879
5-(4-acetylphenyl)-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 4989879) has the molecular formula C28H21Cl3N2O6 and a molecular weight of 587.84 g/mol. Its IUPAC name is 5-(4-acetylphenyl)-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(4-acetylphenyl)-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4989879 |
| Molecular Formula | C28H21Cl3N2O6 |
| Molecular Weight | 587.84 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | 5-(4-acetylphenyl)-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(=O)c1ccc(N2C(=O)C3C(c4cc(Cl)cc(Cl)c4Cl)NC(Cc4ccc(O)cc4)(C(=O)O)C3C2=O)cc1 |
| InChI | InChI=1S/C28H21Cl3N2O6/c1-13(34)15-4-6-17(7-5-15)33-25(36)21-22(26(33)37)28(27(38)39,12-14-2-8-18(35)9-3-14)32-24(21)19-10-16(29)11-20(30)23(19)31/h2-11,21-22,24,32,35H,12H2,1H3,(H,38,39) |
| InChIKey | SAVGRQYWUBXBCV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.84 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|