C23H22N2O8 — CID 124767464
(1S,3S,3aR,6aS)-5-benzyl-3-(2-carboxyethyl)-1-(2,4-dihydroxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 124767464) has the molecular formula C23H22N2O8 and a molecular weight of 454.44 g/mol. Its IUPAC name is (1S,3S,3aR,6aS)-5-benzyl-3-(2-carboxyethyl)-1-(2,4-dihydroxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | (1S,3S,3aR,6aS)-5-benzyl-3-(2-carboxyethyl)-1-(2,4-dihydroxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 124767464 |
| Molecular Formula | C23H22N2O8 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (1S,3S,3aR,6aS)-5-benzyl-3-(2-carboxyethyl)-1-(2,4-dihydroxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)CC[C@]1(C(=O)O)N[C@H](c2ccc(O)cc2O)[C@H]2C(=O)N(Cc3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C23H22N2O8/c26-13-6-7-14(15(27)10-13)19-17-18(23(24-19,22(32)33)9-8-16(28)29)21(31)25(20(17)30)11-12-4-2-1-3-5-12/h1-7,10,17-19,24,26-27H,8-9,11H2,(H,28,29)(H,32,33)/t17-,18-,19+,23-/m0/s1 |
| InChIKey | PMPVVVIIXMDOEB-XWQURZDVSA-N |
| XLogP | 1.23 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|